![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Action Recognition.pdf | 2019-03-18 17:34 | 440K | |
| Attention Driven Image Synthesis.pdf | 2019-03-14 16:17 | 1.4M | |
| Audio Denoising with SEGAN and WaveUnet.pdf | 2019-03-18 17:36 | 1.1M | |
| Comparitive_music_study.pdf | 2019-03-14 16:47 | 5.5M | |
| FastBERT.pdf | 2019-03-18 17:32 | 1.4M | |
| Introducing “Sense” in Visual Common”sense” Reasoning.pdf | 2019-03-14 16:30 | 354K | |
| Out_of_domain_detection.pdf | 2019-03-18 17:34 | 870K | |
| Symbolic_Music_Generation_Final.pdf | 2019-03-18 17:36 | 615K | |
| Temporal Video GAN.pdf | 2019-03-14 16:45 | 468K | |
| VQA_ Visual Question Answering.pdf | 2019-03-18 17:40 | 1.3M | |
| Video Summarization using Transformers.pdf | 2019-03-14 16:43 | 489K | |
| Video_Frame_Prediction.pdf | 2019-03-14 17:19 | 423K | |