![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 2-1 Introduction to Complex FSMs Design.pdf | 2003-08-20 12:17 | 129K | |
| 2-2 Manual Synthesis of RT State descriptions.pdf | 2003-08-20 12:18 | 87K | |
| 2-3 Partitioning-based System Design Methodologies.pdf | 2003-08-20 12:18 | 71K | |
| 2-4 Exercises (Solutions).pdf | 2003-08-20 12:17 | 93K | |
| 74f219a.pdf | 2003-08-20 09:54 | 92K | |
| 74f283.pdf | 2003-08-20 09:53 | 114K | |
| Exercises.pdf | 2003-08-13 12:41 | 26K | |
| hef4516b.pdf | 2003-08-20 09:52 | 130K | |